C29H34N6O7 — CID 59460388
ethyl 4-[5-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]-2-phenylphenoxy]butanoate (PubChem CID 59460388) has the molecular formula C29H34N6O7 and a molecular weight of 578.63 g/mol. Its IUPAC name is ethyl 4-[5-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]-2-phenylphenoxy]butanoate.
| Compound Name | ethyl 4-[5-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]-2-phenylphenoxy]butanoate |
|---|---|
| PubChem CID | 59460388 |
| Molecular Formula | C29H34N6O7 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | ethyl 4-[5-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]-2-phenylphenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cc(CNc2nc3c(N)ncnc3n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C29H34N6O7/c1-2-40-22(37)9-6-12-41-20-13-17(10-11-19(20)18-7-4-3-5-8-18)14-31-29-34-23-26(30)32-16-33-27(23)35(29)28-25(39)24(38)21(15-36)42-28/h3-5,7-8,10-11,13,16,21,24-25,28,36,38-39H,2,6,9,12,14-15H2,1H3,(H,31,34)(H2,30,32,33)/t21-,24-,25-,28-/m1/s1 |
| InChIKey | DHYHYLAOUDNVKI-VGSCBBJJSA-N |
| XLogP | 2.02 |
| TPSA | 187.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|