C26H30N6O5 — CID 59460356
(2R,3R,4S,5R)-2-[6-amino-8-[(4-phenyl-3-propan-2-yloxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 59460356) has the molecular formula C26H30N6O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-[(4-phenyl-3-propan-2-yloxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-[(4-phenyl-3-propan-2-yloxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59460356 |
| Molecular Formula | C26H30N6O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-[(4-phenyl-3-propan-2-yloxyphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)Oc1cc(CNc2nc3c(N)ncnc3n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C26H30N6O5/c1-14(2)36-18-10-15(8-9-17(18)16-6-4-3-5-7-16)11-28-26-31-20-23(27)29-13-30-24(20)32(26)25-22(35)21(34)19(12-33)37-25/h3-10,13-14,19,21-22,25,33-35H,11-12H2,1-2H3,(H,28,31)(H2,27,29,30)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | HSIMALJPTPODBC-PTGPVQHPSA-N |
| XLogP | 2.09 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |