C31H40N8O6 — CID 11570854
3-[4-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]phenyl]-5-[3-(dimethylamino)propoxy]-N,N-dimethylbenzamide (PubChem CID 11570854) has the molecular formula C31H40N8O6 and a molecular weight of 620.71 g/mol. Its IUPAC name is 3-[4-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]phenyl]-5-[3-(dimethylamino)propoxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[4-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]phenyl]-5-[3-(dimethylamino)propoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 11570854 |
| Molecular Formula | C31H40N8O6 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | 3-[4-[[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-8-yl]amino]methyl]phenyl]-5-[3-(dimethylamino)propoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)CCCOc1cc(C(=O)N(C)C)cc(-c2ccc(CNc3nc4c(N)ncnc4n3[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)cc2)c1 |
| InChI | InChI=1S/C31H40N8O6/c1-37(2)10-5-11-44-22-13-20(12-21(14-22)29(43)38(3)4)19-8-6-18(7-9-19)15-33-31-36-24-27(32)34-17-35-28(24)39(31)30-26(42)25(41)23(16-40)45-30/h6-9,12-14,17,23,25-26,30,40-42H,5,10-11,15-16H2,1-4H3,(H,33,36)(H2,32,34,35)/t23-,25-,26-,30-/m1/s1 |
| InChIKey | DKPSLDWLGRJCIU-NYBSAPDNSA-N |
| XLogP | 1.33 |
| TPSA | 184.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|