C17H23N7O4 — CID 59034954
(2R,3R,4S,5R)-2-[6-amino-8-[2-(1-methylpyrrol-2-yl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 59034954) has the molecular formula C17H23N7O4 and a molecular weight of 389.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-8-[2-(1-methylpyrrol-2-yl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-8-[2-(1-methylpyrrol-2-yl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59034954 |
| Molecular Formula | C17H23N7O4 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-8-[2-(1-methylpyrrol-2-yl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Cn1cccc1CCNc1nc2c(N)ncnc2n1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H23N7O4/c1-23-6-2-3-9(23)4-5-19-17-22-11-14(18)20-8-21-15(11)24(17)16-13(27)12(26)10(7-25)28-16/h2-3,6,8,10,12-13,16,25-27H,4-5,7H2,1H3,(H,19,22)(H2,18,20,21)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | IJUBGXVQZIKNJI-XNIJJKJLSA-N |
| XLogP | -0.99 |
| TPSA | 156.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |