C22H27N9O7 — CID 135699135
2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(3-nitro-4-piperidin-1-ylphenyl)methylidene]hydrazinyl]-1H-purin-6-one (PubChem CID 135699135) has the molecular formula C22H27N9O7 and a molecular weight of 529.51 g/mol. Its IUPAC name is 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(3-nitro-4-piperidin-1-ylphenyl)methylidene]hydrazinyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(3-nitro-4-piperidin-1-ylphenyl)methylidene]hydrazinyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135699135 |
| Molecular Formula | C22H27N9O7 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(3-nitro-4-piperidin-1-ylphenyl)methylidene]hydrazinyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(N/N=C/c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)n2C2OC(CO)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C22H27N9O7/c23-21-26-18-15(19(35)27-21)25-22(30(18)20-17(34)16(33)14(10-32)38-20)28-24-9-11-4-5-12(13(8-11)31(36)37)29-6-2-1-3-7-29/h4-5,8-9,14,16-17,20,32-34H,1-3,6-7,10H2,(H,25,28)(H3,23,26,27,35)/b24-9+ |
| InChIKey | ZYCZTSUYBWTLDM-PGGKNCGUSA-N |
| XLogP | -0.34 |
| TPSA | 230.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|