C17H17BrN8O7 — CID 137230560
2-amino-8-[(2E)-2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-9-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 137230560) has the molecular formula C17H17BrN8O7 and a molecular weight of 525.28 g/mol. Its IUPAC name is 2-amino-8-[(2E)-2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-9-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-8-[(2E)-2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-9-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137230560 |
| Molecular Formula | C17H17BrN8O7 |
| Molecular Weight | 525.28 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 2-amino-8-[(2E)-2-[(4-bromo-3-nitrophenyl)methylidene]hydrazinyl]-9-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(N/N=C/c3ccc(Br)c([N+](=O)[O-])c3)n2[C@@H]2O[C@H](CO)[C@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17BrN8O7/c18-7-2-1-6(3-8(7)26(31)32)4-20-24-17-21-10-13(22-16(19)23-14(10)30)25(17)15-12(29)11(28)9(5-27)33-15/h1-4,9,11-12,15,27-29H,5H2,(H,21,24)(H3,19,22,23,30)/b20-4+/t9-,11+,12+,15-/m1/s1 |
| InChIKey | RRWDASUNMJTBTI-PSSBNSSTSA-N |
| XLogP | -0.57 |
| TPSA | 227.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|