C17H18N8O7 — CID 137283878
2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1H-purin-6-one (PubChem CID 137283878) has the molecular formula C17H18N8O7 and a molecular weight of 446.38 g/mol. Its IUPAC name is 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137283878 |
| Molecular Formula | C17H18N8O7 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(N/N=C/c3cccc([N+](=O)[O-])c3)n2C2OC(CO)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H18N8O7/c18-16-21-13-10(14(29)22-16)20-17(24(13)15-12(28)11(27)9(6-26)32-15)23-19-5-7-2-1-3-8(4-7)25(30)31/h1-5,9,11-12,15,26-28H,6H2,(H,20,23)(H3,18,21,22,29)/b19-5+ |
| InChIKey | CDZOFNXZEFGZRU-PTXOJBNSSA-N |
| XLogP | -1.33 |
| TPSA | 227.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|