C17H17Cl2N7O5 — CID 135921247
2-amino-8-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-9-[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135921247) has the molecular formula C17H17Cl2N7O5 and a molecular weight of 470.27 g/mol. Its IUPAC name is 2-amino-8-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-9-[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-8-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-9-[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135921247 |
| Molecular Formula | C17H17Cl2N7O5 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 2-amino-8-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-9-[(2R,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(N/N=C\c3ccc(Cl)cc3Cl)n2[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17Cl2N7O5/c18-7-2-1-6(8(19)3-7)4-21-25-17-22-10-13(23-16(20)24-14(10)30)26(17)15-12(29)11(28)9(5-27)31-15/h1-4,9,11-12,15,27-29H,5H2,(H,22,25)(H3,20,23,24,30)/b21-4-/t9-,11+,12-,15+/m0/s1 |
| InChIKey | QJCCTNWLCPVYAP-DDPNMACZSA-N |
| XLogP | 0.07 |
| TPSA | 183.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|