C18H20N6O7 — CID 135698880
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one (PubChem CID 135698880) has the molecular formula C18H20N6O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135698880 |
| Molecular Formula | C18H20N6O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(2E)-2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one |
| SMILES | COc1ccc(/C=N/Nc2nc3c(=O)[nH]cnc3n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(O)c1 |
| InChI | InChI=1S/C18H20N6O7/c1-30-9-3-2-8(10(26)4-9)5-21-23-18-22-12-15(19-7-20-16(12)29)24(18)17-14(28)13(27)11(6-25)31-17/h2-5,7,11,13-14,17,25-28H,6H2,1H3,(H,22,23)(H,19,20,29)/b21-5+/t11-,13-,14-,17-/m1/s1 |
| InChIKey | NXJFOGLJJYVYRV-WONXFWQZSA-N |
| XLogP | -1.11 |
| TPSA | 187.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|