C20H24N6O8 — CID 135489642
9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one (PubChem CID 135489642) has the molecular formula C20H24N6O8 and a molecular weight of 476.45 g/mol. Its IUPAC name is 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one.
| Compound Name | 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135489642 |
| Molecular Formula | C20H24N6O8 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one |
| SMILES | COc1cc(C=NNc2nc3c(=O)[nH]cnc3n2C2OC(CO)C(O)C2O)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N6O8/c1-31-10-4-9(5-11(32-2)16(10)33-3)6-23-25-20-24-13-17(21-8-22-18(13)30)26(20)19-15(29)14(28)12(7-27)34-19/h4-6,8,12,14-15,19,27-29H,7H2,1-3H3,(H,24,25)(H,21,22,30) |
| InChIKey | IAEQAMXELCGPJJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 185.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|