C20H25N7O7 — CID 167179886
2-[6-amino-2-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 167179886) has the molecular formula C20H25N7O7 and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-[6-amino-2-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[6-amino-2-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 167179886 |
| Molecular Formula | C20H25N7O7 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[6-amino-2-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1cc(/C=N/Nc2nc(N)c3ncn(C4OC(CO)C(O)C4O)c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N7O7/c1-31-10-4-9(5-11(32-2)16(10)33-3)6-23-26-20-24-17(21)13-18(25-20)27(8-22-13)19-15(30)14(29)12(7-28)34-19/h4-6,8,12,14-15,19,28-30H,7H2,1-3H3,(H3,21,24,25,26)/b23-6+ |
| InChIKey | ANMDUUXPKPBIQC-TXNBCWFRSA-N |
| XLogP | -0.51 |
| TPSA | 191.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|