C25H27N7O6 — CID 175369753
(2R,3R,4S,5R)-2-[6-amino-2-[2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 175369753) has the molecular formula C25H27N7O6 and a molecular weight of 521.53 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 175369753 |
| Molecular Formula | C25H27N7O6 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1cc(C=NNc2nc(N)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H27N7O6/c1-36-17-9-15(7-8-16(17)37-12-14-5-3-2-4-6-14)10-28-31-25-29-22(26)19-23(30-25)32(13-27-19)24-21(35)20(34)18(11-33)38-24/h2-10,13,18,20-21,24,33-35H,11-12H2,1H3,(H3,26,29,30,31)/t18-,20-,21-,24-/m1/s1 |
| InChIKey | JIRJGHAYVKLZJF-UMCMBGNQSA-N |
| XLogP | 1.05 |
| TPSA | 182.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|