C18H18F3N7O4 — CID 166042320
(2R,4R,5R)-2-[6-amino-2-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 166042320) has the molecular formula C18H18F3N7O4 and a molecular weight of 453.38 g/mol. Its IUPAC name is (2R,4R,5R)-2-[6-amino-2-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,4R,5R)-2-[6-amino-2-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 166042320 |
| Molecular Formula | C18H18F3N7O4 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (2R,4R,5R)-2-[6-amino-2-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(N/N=C/c2ccc(C(F)(F)F)cc2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@H](O)C1O |
| InChI | InChI=1S/C18H18F3N7O4/c19-18(20,21)9-3-1-8(2-4-9)5-24-27-17-25-14(22)11-15(26-17)28(7-23-11)16-13(31)12(30)10(6-29)32-16/h1-5,7,10,12-13,16,29-31H,6H2,(H3,22,25,26,27)/b24-5+/t10-,12+,13?,16-/m1/s1 |
| InChIKey | NWBCWRIQUQNCRT-HZJAWQOYSA-N |
| XLogP | 0.48 |
| TPSA | 163.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|