C18H17F3N6O4 — CID 166042292
(2R,4S,5R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol (PubChem CID 166042292) has the molecular formula C18H17F3N6O4 and a molecular weight of 438.37 g/mol. Its IUPAC name is (2R,4S,5R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,4S,5R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 166042292 |
| Molecular Formula | C18H17F3N6O4 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (2R,4S,5R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(N/N=C/c4ccc(C(F)(F)F)cc4)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C18H17F3N6O4/c19-18(20,21)10-3-1-9(2-4-10)5-25-26-15-12-16(23-7-22-15)27(8-24-12)17-14(30)13(29)11(6-28)31-17/h1-5,7-8,11,13-14,17,28-30H,6H2,(H,22,23,26)/b25-5+/t11-,13?,14+,17-/m1/s1 |
| InChIKey | FUWVXXDKDNIECI-ZEWVHFFYSA-N |
| XLogP | 0.90 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|