C16H18N6O4S — CID 89306916
(2R,3S,4R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[(5-methylthiophen-2-yl)methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol (PubChem CID 89306916) has the molecular formula C16H18N6O4S and a molecular weight of 390.43 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[(5-methylthiophen-2-yl)methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[(5-methylthiophen-2-yl)methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 89306916 |
| Molecular Formula | C16H18N6O4S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[(5-methylthiophen-2-yl)methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol |
| SMILES | Cc1ccc(/C=N/Nc2ncnc3c2ncn3C2O[C@H](CO)[C@@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C16H18N6O4S/c1-8-2-3-9(27-8)4-20-21-14-11-15(18-6-17-14)22(7-19-11)16-13(25)12(24)10(5-23)26-16/h2-4,6-7,10,12-13,16,23-25H,5H2,1H3,(H,17,18,21)/b20-4+/t10-,12-,13-,16?/m1/s1 |
| InChIKey | IJBPWTKSFRBZQE-SAVVFDNYSA-N |
| XLogP | 0.25 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|