C11H15N9Na4O12 — CID 24832760
tetrasodium;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxolane-3,4-diol;tetranitrite (PubChem CID 24832760) has the molecular formula C11H15N9Na4O12 and a molecular weight of 557.25 g/mol. Its IUPAC name is tetrasodium;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxolane-3,4-diol;tetranitrite.
| Compound Name | tetrasodium;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxolane-3,4-diol;tetranitrite |
|---|---|
| PubChem CID | 24832760 |
| Molecular Formula | C11H15N9Na4O12 |
| Molecular Weight | 557.25 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | tetrasodium;(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxolane-3,4-diol;tetranitrite |
| SMILES | CNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.O=N[O-].O=N[O-].O=N[O-].O=N[O-].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C11H15N5O4.4HNO2.4Na/c1-12-9-6-10(14-3-13-9)16(4-15-6)11-8(19)7(18)5(2-17)20-11;4*2-1-3;;;;/h3-5,7-8,11,17-19H,2H2,1H3,(H,12,13,14);4*(H,2,3);;;;/q;;;;;4*+1/p-4/t5-,7-,8-,11-;;;;;;;;/m1......../s1 |
| InChIKey | GXXPMWALWVCHJK-VMHBFUBRSA-J |
| XLogP | -12.50 |
| TPSA | 335.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.25 |
| LogP ≤ 5 | -12.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|