C14H19N5O4 — CID 46874635
(2R,3S,4R)-2-(hydroxymethyl)-5-[6-(2-methylprop-2-enylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 46874635) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(2-methylprop-2-enylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(2-methylprop-2-enylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46874635 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(2-methylprop-2-enylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | C=C(C)CNc1ncnc2c1ncn2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19N5O4/c1-7(2)3-15-12-9-13(17-5-16-12)19(6-18-9)14-11(22)10(21)8(4-20)23-14/h5-6,8,10-11,14,20-22H,1,3-4H2,2H3,(H,15,16,17)/t8-,10-,11-,14?/m1/s1 |
| InChIKey | NEUYKBQKOBZILD-OYBGHCQBSA-N |
| XLogP | -0.57 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|