C16H23N5O6 — CID 169447794
(2S,4S,6R)-2-(hydroxymethyl)-6-[6-[[(E)-4-hydroxy-3-methylbut-2-enyl]amino]purin-9-yl]oxane-3,4,5-triol (PubChem CID 169447794) has the molecular formula C16H23N5O6 and a molecular weight of 381.39 g/mol. Its IUPAC name is (2S,4S,6R)-2-(hydroxymethyl)-6-[6-[[(E)-4-hydroxy-3-methylbut-2-enyl]amino]purin-9-yl]oxane-3,4,5-triol.
| Compound Name | (2S,4S,6R)-2-(hydroxymethyl)-6-[6-[[(E)-4-hydroxy-3-methylbut-2-enyl]amino]purin-9-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 169447794 |
| Molecular Formula | C16H23N5O6 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (2S,4S,6R)-2-(hydroxymethyl)-6-[6-[[(E)-4-hydroxy-3-methylbut-2-enyl]amino]purin-9-yl]oxane-3,4,5-triol |
| SMILES | C/C(=C\CNc1ncnc2c1ncn2[C@@H]1O[C@@H](CO)C(O)[C@H](O)C1O)CO |
| InChI | InChI=1S/C16H23N5O6/c1-8(4-22)2-3-17-14-10-15(19-6-18-14)21(7-20-10)16-13(26)12(25)11(24)9(5-23)27-16/h2,6-7,9,11-13,16,22-26H,3-5H2,1H3,(H,17,18,19)/b8-2+/t9-,11?,12-,13?,16+/m0/s1 |
| InChIKey | VYRAJOITMBSQSE-XKEYPCIUSA-N |
| XLogP | -1.85 |
| TPSA | 166.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|