C15H22N5O7PS — CID 14628964
(2R,3R,4S,5R)-2-[6-[[(E)-4-dihydroxyphosphinothioyloxy-3-methylbut-2-enyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 14628964) has the molecular formula C15H22N5O7PS and a molecular weight of 447.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[[(E)-4-dihydroxyphosphinothioyloxy-3-methylbut-2-enyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[[(E)-4-dihydroxyphosphinothioyloxy-3-methylbut-2-enyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 14628964 |
| Molecular Formula | C15H22N5O7PS |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[[(E)-4-dihydroxyphosphinothioyloxy-3-methylbut-2-enyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C/C(=C\CNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)COP(O)(O)=S |
| InChI | InChI=1S/C15H22N5O7PS/c1-8(5-26-28(24,25)29)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(4-21)27-15/h2,6-7,9,11-12,15,21-23H,3-5H2,1H3,(H,16,17,18)(H2,24,25,29)/b8-2+/t9-,11-,12-,15-/m1/s1 |
| InChIKey | LJCQHJRPDKNDJP-HNNGNKQASA-N |
| XLogP | -0.98 |
| TPSA | 175.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|