C17H29N6O4+ — CID 67942798
2-[[9-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl-diethyl-methylazanium (PubChem CID 67942798) has the molecular formula C17H29N6O4+ and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[[9-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl-diethyl-methylazanium.
| Compound Name | 2-[[9-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 67942798 |
| Molecular Formula | C17H29N6O4+ |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[[9-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCNc1ncnc2c1ncn2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H29N6O4/c1-4-23(3,5-2)7-6-18-15-12-16(20-9-19-15)22(10-21-12)17-14(26)13(25)11(8-24)27-17/h9-11,13-14,17,24-26H,4-8H2,1-3H3,(H,18,19,20)/q+1/t11-,13-,14-,17?/m1/s1 |
| InChIKey | ZHLTYORQORHBFU-IKYDMHQPSA-N |
| XLogP | -0.66 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|