C20H24N6O5 — CID 166042296
(2R,4S,5R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[(4-propoxyphenyl)methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol (PubChem CID 166042296) has the molecular formula C20H24N6O5 and a molecular weight of 428.45 g/mol. Its IUPAC name is (2R,4S,5R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[(4-propoxyphenyl)methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,4S,5R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[(4-propoxyphenyl)methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 166042296 |
| Molecular Formula | C20H24N6O5 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (2R,4S,5R)-2-(hydroxymethyl)-5-[6-[(2E)-2-[(4-propoxyphenyl)methylidene]hydrazinyl]purin-9-yl]oxolane-3,4-diol |
| SMILES | CCCOc1ccc(/C=N/Nc2ncnc3c2ncn3[C@@H]2O[C@H](CO)C(O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H24N6O5/c1-2-7-30-13-5-3-12(4-6-13)8-24-25-18-15-19(22-10-21-18)26(11-23-15)20-17(29)16(28)14(9-27)31-20/h3-6,8,10-11,14,16-17,20,27-29H,2,7,9H2,1H3,(H,21,22,25)/b24-8+/t14-,16?,17+,20-/m1/s1 |
| InChIKey | VKDSCRHLNKMONT-DWZCTLMOSA-N |
| XLogP | 0.67 |
| TPSA | 147.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|