C18H17N5O6S — CID 87845700
(4-methanethioylphenyl) N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamate (PubChem CID 87845700) has the molecular formula C18H17N5O6S and a molecular weight of 431.43 g/mol. Its IUPAC name is (4-methanethioylphenyl) N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamate.
| Compound Name | (4-methanethioylphenyl) N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 87845700 |
| Molecular Formula | C18H17N5O6S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (4-methanethioylphenyl) N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]carbamate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)Oc1ccc(C=S)cc1 |
| InChI | InChI=1S/C18H17N5O6S/c24-5-11-13(25)14(26)17(29-11)23-8-21-12-15(19-7-20-16(12)23)22-18(27)28-10-3-1-9(6-30)2-4-10/h1-4,6-8,11,13-14,17,24-26H,5H2,(H,19,20,22,27)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | UWZDQOAYAWIXJJ-LSCFUAHRSA-N |
| XLogP | 0.40 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|