C17H19N7O7 — CID 135510170
2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one (PubChem CID 135510170) has the molecular formula C17H19N7O7 and a molecular weight of 433.38 g/mol. Its IUPAC name is 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135510170 |
| Molecular Formula | C17H19N7O7 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(NN=Cc3ccc(O)cc3O)n2C2OC(CO)C(O)C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C17H19N7O7/c18-16-21-13-10(14(30)22-16)20-17(23-19-4-6-1-2-7(26)3-8(6)27)24(13)15-12(29)11(28)9(5-25)31-15/h1-4,9,11-12,15,25-29H,5H2,(H,20,23)(H3,18,21,22,30) |
| InChIKey | JALOBGCHOYFPIW-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 224.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|