C10H12N6O7 — CID 137176532
2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-nitro-1H-purin-6-one (PubChem CID 137176532) has the molecular formula C10H12N6O7 and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-nitro-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-nitro-1H-purin-6-one |
|---|---|
| PubChem CID | 137176532 |
| Molecular Formula | C10H12N6O7 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-nitro-1H-purin-6-one |
| SMILES | Nc1nc2c(nc([N+](=O)[O-])n2[C@@H]2O[C@H](CO)[C@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N6O7/c11-9-13-6-3(7(20)14-9)12-10(16(21)22)15(6)8-5(19)4(18)2(1-17)23-8/h2,4-5,8,17-19H,1H2,(H3,11,13,14,20)/t2-,4+,5-,8-/m1/s1 |
| InChIKey | KGUOMRFOXYDMAH-SAFLGMAISA-N |
| XLogP | -2.78 |
| TPSA | 202.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|