C10H14N5O8P — CID 175301298
[2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-8-yl]phosphonic acid (PubChem CID 175301298) has the molecular formula C10H14N5O8P and a molecular weight of 363.22 g/mol. Its IUPAC name is [2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-8-yl]phosphonic acid.
| Compound Name | [2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-8-yl]phosphonic acid |
|---|---|
| PubChem CID | 175301298 |
| Molecular Formula | C10H14N5O8P |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | [2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-8-yl]phosphonic acid |
| SMILES | Nc1nc2c(nc(P(=O)(O)O)n2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N5O8P/c11-9-13-6-3(7(19)14-9)12-10(24(20,21)22)15(6)8-5(18)4(17)2(1-16)23-8/h2,4-5,8,16-18H,1H2,(H2,20,21,22)(H3,11,13,14,19)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | UVBLICUSHGMRGN-UMMCILCDSA-N |
| XLogP | -3.88 |
| TPSA | 217.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|