C10H12N8O5 — CID 135800808
2-amino-8-azido-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135800808) has the molecular formula C10H12N8O5 and a molecular weight of 324.26 g/mol. Its IUPAC name is 2-amino-8-azido-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-8-azido-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135800808 |
| Molecular Formula | C10H12N8O5 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-amino-8-azido-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | [N-]=[N+]=Nc1nc2c(=O)[nH]c(N)nc2n1C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H12N8O5/c11-9-14-6-3(7(22)15-9)13-10(16-17-12)18(6)8-5(21)4(20)2(1-19)23-8/h2,4-5,8,19-21H,1H2,(H3,11,14,15,22) |
| InChIKey | YSFMXIULKVUVMD-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 208.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|