C16H24N8O17P2 — CID 175676034
[[(2R,3S,4R,5R)-5-(2-amino-8-azido-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (1,2,3,4,5-pentahydroxy-6-oxohexyl) hydrogen phosphate (PubChem CID 175676034) has the molecular formula C16H24N8O17P2 and a molecular weight of 662.35 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-8-azido-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (1,2,3,4,5-pentahydroxy-6-oxohexyl) hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-8-azido-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (1,2,3,4,5-pentahydroxy-6-oxohexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 175676034 |
| Molecular Formula | C16H24N8O17P2 |
| Molecular Weight | 662.35 g/mol |
| Exact Mass | 662.07 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-8-azido-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] (1,2,3,4,5-pentahydroxy-6-oxohexyl) hydrogen phosphate |
| SMILES | [N-]=[N+]=Nc1nc2c(=O)[nH]c(N)nc2n1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OC(O)C(O)C(O)C(O)C(O)C=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H24N8O17P2/c17-15-20-11-5(12(32)21-15)19-16(22-23-18)24(11)13-9(30)7(28)4(39-13)2-38-42(34,35)41-43(36,37)40-14(33)10(31)8(29)6(27)3(26)1-25/h1,3-4,6-10,13-14,26-31,33H,2H2,(H,34,35)(H,36,37)(H3,17,20,21,32)/t3?,4-,6?,7-,8?,9-,10?,13-,14?/m1/s1 |
| InChIKey | MIDZPVFMAALQAS-GQKMSVBMSA-N |
| XLogP | -4.53 |
| TPSA | 408.55 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.35 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|