C10H13BrN5NaO8P — CID 135445684
8-Bromoguanosine 5'-monophosphate sodium salt, 95-98% (PubChem CID 135445684) has the molecular formula C10H13BrN5NaO8P and a molecular weight of 465.11 g/mol.
| Compound Name | 8-Bromoguanosine 5'-monophosphate sodium salt, 95-98% |
|---|---|
| PubChem CID | 135445684 |
| Molecular Formula | C10H13BrN5NaO8P |
| Molecular Weight | 465.11 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(nc(Br)n2C2OC(COP(=O)(O)O)C(O)C2O)c(=O)[nH]1.[Na] |
| InChI | InChI=1S/C10H13BrN5O8P.Na/c11-9-13-3-6(14-10(12)15-7(3)19)16(9)8-5(18)4(17)2(24-8)1-23-25(20,21)22;/h2,4-5,8,17-18H,1H2,(H2,20,21,22)(H3,12,14,15,19); |
| InChIKey | CMPGYSGSGGRYCP-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 206.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.11 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|