C10H12BrN5NaO8P — CID 155897225
sodium [5-(2-amino-8-bromo-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 155897225) has the molecular formula C10H12BrN5NaO8P and a molecular weight of 464.10 g/mol. Its IUPAC name is sodium [5-(2-amino-8-bromo-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | sodium [5-(2-amino-8-bromo-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 155897225 |
| Molecular Formula | C10H12BrN5NaO8P |
| Molecular Weight | 464.10 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | sodium [5-(2-amino-8-bromo-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc2c(nc(Br)n2C2OC(COP(=O)([O-])O)C(O)C2O)c(=O)[nH]1.[Na+] |
| InChI | InChI=1S/C10H13BrN5O8P.Na/c11-9-13-3-6(14-10(12)15-7(3)19)16(9)8-5(18)4(17)2(24-8)1-23-25(20,21)22;/h2,4-5,8,17-18H,1H2,(H2,20,21,22)(H3,12,14,15,19);/q;+1/p-1 |
| InChIKey | IDIWPJBQUGBYEI-UHFFFAOYSA-M |
| XLogP | -5.44 |
| TPSA | 208.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.10 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|