C18H22N5O8P — CID 136511194
[(2R,3S,4R,5R)-5-[2-amino-8-(4-ethylphenyl)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 136511194) has the molecular formula C18H22N5O8P and a molecular weight of 467.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-amino-8-(4-ethylphenyl)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[2-amino-8-(4-ethylphenyl)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 136511194 |
| Molecular Formula | C18H22N5O8P |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-amino-8-(4-ethylphenyl)-6-oxo-1H-purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCc1ccc(-c2nc3c(=O)[nH]c(N)nc3n2[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C18H22N5O8P/c1-2-8-3-5-9(6-4-8)14-20-11-15(21-18(19)22-16(11)26)23(14)17-13(25)12(24)10(31-17)7-30-32(27,28)29/h3-6,10,12-13,17,24-25H,2,7H2,1H3,(H2,27,28,29)(H3,19,21,22,26)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | WSGNNVOBADFHAO-CNEMSGBDSA-N |
| XLogP | -0.34 |
| TPSA | 206.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|