C11H15N4O8P — CID 135407841
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(8-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 135407841) has the molecular formula C11H15N4O8P and a molecular weight of 362.24 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(8-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(8-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135407841 |
| Molecular Formula | C11H15N4O8P |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(8-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1nc2c(=O)[nH]cnc2n1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H15N4O8P/c1-4-14-6-9(12-3-13-10(6)18)15(4)11-8(17)7(16)5(23-11)2-22-24(19,20)21/h3,5,7-8,11,16-17H,2H2,1H3,(H,12,13,18)(H2,19,20,21)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | VLFKITZKYZWNDF-IOSLPCCCSA-N |
| XLogP | -1.84 |
| TPSA | 180.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|