C10H12ClN4O7P — CID 137092605
[4-chloro-3-hydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 137092605) has the molecular formula C10H12ClN4O7P and a molecular weight of 366.65 g/mol. Its IUPAC name is [4-chloro-3-hydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [4-chloro-3-hydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137092605 |
| Molecular Formula | C10H12ClN4O7P |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | [4-chloro-3-hydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]cnc2c1ncn2C1OC(COP(=O)(O)O)C(O)C1Cl |
| InChI | InChI=1S/C10H12ClN4O7P/c11-5-7(16)4(1-21-23(18,19)20)22-10(5)15-3-14-6-8(15)12-2-13-9(6)17/h2-5,7,10,16H,1H2,(H,12,13,17)(H2,18,19,20) |
| InChIKey | UQJKSGMKPSNLLF-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 159.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|