C13H17N4O8P — CID 137108384
[2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 137108384) has the molecular formula C13H17N4O8P and a molecular weight of 388.27 g/mol. Its IUPAC name is [2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137108384 |
| Molecular Formula | C13H17N4O8P |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | CC1(C)OC2C(COP(=O)(O)O)OC(n3cnc4c(=O)[nH]cnc43)C2O1 |
| InChI | InChI=1S/C13H17N4O8P/c1-13(2)24-8-6(3-22-26(19,20)21)23-12(9(8)25-13)17-5-16-7-10(17)14-4-15-11(7)18/h4-6,8-9,12H,3H2,1-2H3,(H,14,15,18)(H2,19,20,21) |
| InChIKey | ZHTIWMLRNZUBCH-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|