C20H20N4O7 — CID 135459447
[2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl phenyl carbonate (PubChem CID 135459447) has the molecular formula C20H20N4O7 and a molecular weight of 428.40 g/mol. Its IUPAC name is [2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl phenyl carbonate.
| Compound Name | [2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl phenyl carbonate |
|---|---|
| PubChem CID | 135459447 |
| Molecular Formula | C20H20N4O7 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl phenyl carbonate |
| SMILES | CC1(C)OC2C(COC(=O)Oc3ccccc3)OC(n3cnc4c(=O)[nH]cnc43)C2O1 |
| InChI | InChI=1S/C20H20N4O7/c1-20(2)30-14-12(8-27-19(26)28-11-6-4-3-5-7-11)29-18(15(14)31-20)24-10-23-13-16(24)21-9-22-17(13)25/h3-7,9-10,12,14-15,18H,8H2,1-2H3,(H,21,22,25) |
| InChIKey | PSIMSYIQWZUVHW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|