C20H18N6O10 — CID 135590419
[(3aR,4S,6R,6aS)-2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 3,5-dinitrobenzoate (PubChem CID 135590419) has the molecular formula C20H18N6O10 and a molecular weight of 502.40 g/mol. Its IUPAC name is [(3aR,4S,6R,6aS)-2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 3,5-dinitrobenzoate.
| Compound Name | [(3aR,4S,6R,6aS)-2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 135590419 |
| Molecular Formula | C20H18N6O10 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | [(3aR,4S,6R,6aS)-2,2-dimethyl-4-(6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 3,5-dinitrobenzoate |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](n1cnc3c(=O)[nH]cnc31)O[C@@H]2COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N6O10/c1-20(2)35-14-12(6-33-19(28)9-3-10(25(29)30)5-11(4-9)26(31)32)34-18(15(14)36-20)24-8-23-13-16(24)21-7-22-17(13)27/h3-5,7-8,12,14-15,18H,6H2,1-2H3,(H,21,22,27)/t12-,14+,15-,18+/m1/s1 |
| InChIKey | KJWHSGWFGVPAEQ-PXMRGAAZSA-N |
| XLogP | 1.21 |
| TPSA | 203.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|