C24H27N5O8 — CID 71056233
[(3aR,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylate (PubChem CID 71056233) has the molecular formula C24H27N5O8 and a molecular weight of 513.51 g/mol. Its IUPAC name is [(3aR,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylate.
| Compound Name | [(3aR,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 71056233 |
| Molecular Formula | C24H27N5O8 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | [(3aR,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 1,3-dimethoxy-1,3-dihydro-2-benzofuran-5-carboxylate |
| SMILES | COC1OC(OC)c2cc(C(=O)OCC3OC(n4cnc5c(N)ncnc54)[C@@H]4OC(C)(C)O[C@H]34)ccc21 |
| InChI | InChI=1S/C24H27N5O8/c1-24(2)36-16-14(34-20(17(16)37-24)29-10-28-15-18(25)26-9-27-19(15)29)8-33-21(30)11-5-6-12-13(7-11)23(32-4)35-22(12)31-3/h5-7,9-10,14,16-17,20,22-23H,8H2,1-4H3,(H2,25,26,27)/t14?,16-,17-,20?,22?,23?/m1/s1 |
| InChIKey | QQNHSLJRSDGGHO-DQSOSAJKSA-N |
| XLogP | 2.00 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |