C21H21N5O6 — CID 59824666
[(4R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-formylbenzoate (PubChem CID 59824666) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is [(4R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-formylbenzoate.
| Compound Name | [(4R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-formylbenzoate |
|---|---|
| PubChem CID | 59824666 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [(4R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-formylbenzoate |
| SMILES | CC1(C)OC2[C@H](O1)C(COC(=O)c1ccc(C=O)cc1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C21H21N5O6/c1-21(2)31-15-13(8-29-20(28)12-5-3-11(7-27)4-6-12)30-19(16(15)32-21)26-10-25-14-17(22)23-9-24-18(14)26/h3-7,9-10,13,15-16,19H,8H2,1-2H3,(H2,22,23,24)/t13?,15-,16?,19-/m1/s1 |
| InChIKey | FJPXINCZWNCOBM-PRPBGHMLSA-N |
| XLogP | 1.50 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|