C18H26N6O5 — CID 58918734
ethyl 2-[[(3aS,4R,6R)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]acetate (PubChem CID 58918734) has the molecular formula C18H26N6O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is ethyl 2-[[(3aS,4R,6R)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]acetate.
| Compound Name | ethyl 2-[[(3aS,4R,6R)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]acetate |
|---|---|
| PubChem CID | 58918734 |
| Molecular Formula | C18H26N6O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | ethyl 2-[[(3aS,4R,6R)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C18H26N6O5/c1-5-26-11(25)7-23(4)6-10-13-14(29-18(2,3)28-13)17(27-10)24-9-22-12-15(19)20-8-21-16(12)24/h8-10,13-14,17H,5-7H2,1-4H3,(H2,19,20,21)/t10-,13?,14+,17-/m1/s1 |
| InChIKey | FWCPOCSBDAVSCO-WYNAFHSXSA-N |
| XLogP | 0.32 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |