C26H40N6O5 — CID 126703529
ethyl 4-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]cyclobutyl]butanoate (PubChem CID 126703529) has the molecular formula C26H40N6O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is ethyl 4-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]cyclobutyl]butanoate.
| Compound Name | ethyl 4-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]cyclobutyl]butanoate |
|---|---|
| PubChem CID | 126703529 |
| Molecular Formula | C26H40N6O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | ethyl 4-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]cyclobutyl]butanoate |
| SMILES | CCOC(=O)CCCC1CC(N(C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H]3OC(C)(C)O[C@@H]32)C(C)C)C1 |
| InChI | InChI=1S/C26H40N6O5/c1-6-34-19(33)9-7-8-16-10-17(11-16)31(15(2)3)12-18-21-22(37-26(4,5)36-21)25(35-18)32-14-30-20-23(27)28-13-29-24(20)32/h13-18,21-22,25H,6-12H2,1-5H3,(H2,27,28,29)/t16?,17?,18-,21-,22-,25-/m1/s1 |
| InChIKey | SNFAZXQURWQYOM-JDEPZOBDSA-N |
| XLogP | 3.05 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |