C30H40N6O5 — CID 67774489
benzyl 3-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]cyclobutyl]propanoate (PubChem CID 67774489) has the molecular formula C30H40N6O5 and a molecular weight of 564.69 g/mol. Its IUPAC name is benzyl 3-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]cyclobutyl]propanoate.
| Compound Name | benzyl 3-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]cyclobutyl]propanoate |
|---|---|
| PubChem CID | 67774489 |
| Molecular Formula | C30H40N6O5 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | benzyl 3-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-propan-2-ylamino]cyclobutyl]propanoate |
| SMILES | CC(C)N(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21)C1CC(CCC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C30H40N6O5/c1-18(2)35(21-12-20(13-21)10-11-23(37)38-15-19-8-6-5-7-9-19)14-22-25-26(41-30(3,4)40-25)29(39-22)36-17-34-24-27(31)32-16-33-28(24)36/h5-9,16-18,20-22,25-26,29H,10-15H2,1-4H3,(H2,31,32,33)/t20?,21?,22-,25-,26-,29-/m1/s1 |
| InChIKey | FNLGNKVSVUHWHB-CSOOHYIVSA-N |
| XLogP | 3.84 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |