C23H34N6O5 — CID 67774466
ethyl 3-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]cyclobutyl]propanoate (PubChem CID 67774466) has the molecular formula C23H34N6O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is ethyl 3-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]cyclobutyl]propanoate.
| Compound Name | ethyl 3-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]cyclobutyl]propanoate |
|---|---|
| PubChem CID | 67774466 |
| Molecular Formula | C23H34N6O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | ethyl 3-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]cyclobutyl]propanoate |
| SMILES | CCOC(=O)CCC1CC(N(C)C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H]3OC(C)(C)O[C@@H]32)C1 |
| InChI | InChI=1S/C23H34N6O5/c1-5-31-16(30)7-6-13-8-14(9-13)28(4)10-15-18-19(34-23(2,3)33-18)22(32-15)29-12-27-17-20(24)25-11-26-21(17)29/h11-15,18-19,22H,5-10H2,1-4H3,(H2,24,25,26)/t13?,14?,15-,18-,19-,22-/m1/s1 |
| InChIKey | CSTGAHANYNMRNL-WVZOKUCMSA-N |
| XLogP | 1.88 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |