C19H28N6O5 — CID 67989010
5-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]pentanoic acid (PubChem CID 67989010) has the molecular formula C19H28N6O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 5-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]pentanoic acid.
| Compound Name | 5-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]pentanoic acid |
|---|---|
| PubChem CID | 67989010 |
| Molecular Formula | C19H28N6O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 5-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]pentanoic acid |
| SMILES | CN(CCCCC(=O)O)C[C@H]1OC(n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H28N6O5/c1-19(2)29-14-11(8-24(3)7-5-4-6-12(26)27)28-18(15(14)30-19)25-10-23-13-16(20)21-9-22-17(13)25/h9-11,14-15,18H,4-8H2,1-3H3,(H,26,27)(H2,20,21,22)/t11-,14-,15-,18?/m1/s1 |
| InChIKey | LDIXKCJFKYPVOA-HETNKJQDSA-N |
| XLogP | 1.01 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|