C17H27N7O3 — CID 67989120
N'-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 67989120) has the molecular formula C17H27N7O3 and a molecular weight of 377.45 g/mol. Its IUPAC name is N'-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 67989120 |
| Molecular Formula | C17H27N7O3 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N'-[[(3aR,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)C[C@H]1OC(n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C17H27N7O3/c1-17(2)26-12-10(7-23(4)6-5-19-3)25-16(13(12)27-17)24-9-22-11-14(18)20-8-21-15(11)24/h8-10,12-13,16,19H,5-7H2,1-4H3,(H2,18,20,21)/t10-,12-,13-,16?/m1/s1 |
| InChIKey | LCCJWZFNUANGGJ-AARXTDBFSA-N |
| XLogP | -0.02 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |