C27H38N8O4 — CID 90064308
1-[2-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]ethyl]-3-(4-tert-butylphenyl)urea (PubChem CID 90064308) has the molecular formula C27H38N8O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is 1-[2-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]ethyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[2-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]ethyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 90064308 |
| Molecular Formula | C27H38N8O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | 1-[2-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]ethyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CN(CCNC(=O)Nc1ccc(C(C)(C)C)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C27H38N8O4/c1-26(2,3)16-7-9-17(10-8-16)33-25(36)29-11-12-34(6)13-18-20-21(39-27(4,5)38-20)24(37-18)35-15-32-19-22(28)30-14-31-23(19)35/h7-10,14-15,18,20-21,24H,11-13H2,1-6H3,(H2,28,30,31)(H2,29,33,36)/t18-,20-,21-,24-/m1/s1 |
| InChIKey | BOTMWGWRUIKSLJ-UMCMBGNQSA-N |
| XLogP | 2.88 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |