C27H37N7O5S — CID 67975426
1-[3-[[(4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfinyl]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 67975426) has the molecular formula C27H37N7O5S and a molecular weight of 571.70 g/mol. Its IUPAC name is 1-[3-[[(4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfinyl]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfinyl]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 67975426 |
| Molecular Formula | C27H37N7O5S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 1-[3-[[(4R,6S,6aS)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfinyl]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC1(C)OC2[C@H](n3cnc4c(N)ncnc43)O[C@H](CS(=O)CCCNC(=O)Nc3ccc(C(C)(C)C)cc3)[C@H]2O1 |
| InChI | InChI=1S/C27H37N7O5S/c1-26(2,3)16-7-9-17(10-8-16)33-25(35)29-11-6-12-40(36)13-18-20-21(39-27(4,5)38-20)24(37-18)34-15-32-19-22(28)30-14-31-23(19)34/h7-10,14-15,18,20-21,24H,6,11-13H2,1-5H3,(H2,28,30,31)(H2,29,33,35)/t18-,20-,21?,24-,40?/m1/s1 |
| InChIKey | AKGAYEJJRVQUFO-HPEGROBZSA-N |
| XLogP | 3.08 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|