C24H33N7O5S — CID 123392733
1-[3-[[4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfinyl]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 123392733) has the molecular formula C24H33N7O5S and a molecular weight of 531.64 g/mol. Its IUPAC name is 1-[3-[[4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfinyl]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfinyl]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 123392733 |
| Molecular Formula | C24H33N7O5S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 1-[3-[[4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfinyl]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCCS(=O)CC2OCC(O)(n3cnc4c(N)ncnc43)C2O)cc1 |
| InChI | InChI=1S/C24H33N7O5S/c1-23(2,3)15-5-7-16(8-6-15)30-22(33)26-9-4-10-37(35)11-17-19(32)24(34,12-36-17)31-14-29-18-20(25)27-13-28-21(18)31/h5-8,13-14,17,19,32,34H,4,9-12H2,1-3H3,(H2,25,27,28)(H2,26,30,33) |
| InChIKey | HNUPIGVCEDUKRP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 177.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|