C25H33N7O4S — CID 163702950
(3R,4R)-4-(6-aminopurin-9-yl)-2-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfinylmethyl]oxolane-3,4-diol (PubChem CID 163702950) has the molecular formula C25H33N7O4S and a molecular weight of 527.65 g/mol. Its IUPAC name is (3R,4R)-4-(6-aminopurin-9-yl)-2-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfinylmethyl]oxolane-3,4-diol.
| Compound Name | (3R,4R)-4-(6-aminopurin-9-yl)-2-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfinylmethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 163702950 |
| Molecular Formula | C25H33N7O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | (3R,4R)-4-(6-aminopurin-9-yl)-2-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfinylmethyl]oxolane-3,4-diol |
| SMILES | CC(C)(C)c1ccc2nc(CCCCS(=O)CC3OC[C@](O)(n4cnc5c(N)ncnc54)[C@@H]3O)[nH]c2c1 |
| InChI | InChI=1S/C25H33N7O4S/c1-24(2,3)15-7-8-16-17(10-15)31-19(30-16)6-4-5-9-37(35)11-18-21(33)25(34,12-36-18)32-14-29-20-22(26)27-13-28-23(20)32/h7-8,10,13-14,18,21,33-34H,4-6,9,11-12H2,1-3H3,(H,30,31)(H2,26,27,28)/t18?,21-,25-,37?/m1/s1 |
| InChIKey | KCPRYSOHFNSJQB-VTGVYYERSA-N |
| XLogP | 1.76 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|