C25H33N7O3S — CID 67975506
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfanylmethyl]oxolane-3,4-diol (PubChem CID 67975506) has the molecular formula C25H33N7O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfanylmethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfanylmethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 67975506 |
| Molecular Formula | C25H33N7O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[4-(6-tert-butyl-1H-benzimidazol-2-yl)butylsulfanylmethyl]oxolane-3,4-diol |
| SMILES | CC(C)(C)c1ccc2nc(CCCCSC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[nH]c2c1 |
| InChI | InChI=1S/C25H33N7O3S/c1-25(2,3)14-7-8-15-16(10-14)31-18(30-15)6-4-5-9-36-11-17-20(33)21(34)24(35-17)32-13-29-19-22(26)27-12-28-23(19)32/h7-8,10,12-13,17,20-21,24,33-34H,4-6,9,11H2,1-3H3,(H,30,31)(H2,26,27,28)/t17-,20-,21-,24-/m1/s1 |
| InChIKey | YWOKPPHAOVNTTE-FGSUIDRYSA-N |
| XLogP | 2.96 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|