C17H18N8O3S — CID 142801965
(2S,3S,4R)-2-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol (PubChem CID 142801965) has the molecular formula C17H18N8O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is (2S,3S,4R)-2-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R)-2-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 142801965 |
| Molecular Formula | C17H18N8O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (2S,3S,4R)-2-[(6-amino-1H-benzimidazol-2-yl)sulfanylmethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
| SMILES | Nc1ccc2nc(SC[C@H]3OC(n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[nH]c2c1 |
| InChI | InChI=1S/C17H18N8O3S/c18-7-1-2-8-9(3-7)24-17(23-8)29-4-10-12(26)13(27)16(28-10)25-6-22-11-14(19)20-5-21-15(11)25/h1-3,5-6,10,12-13,16,26-27H,4,18H2,(H,23,24)(H2,19,20,21)/t10-,12-,13-,16?/m1/s1 |
| InChIKey | WNVBPSXXDYMPEQ-AARXTDBFSA-N |
| XLogP | 0.28 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|