C19H18N6O3S — CID 155315102
(2R,3R,4S)-2-(6-aminopurin-9-yl)-5-(quinolin-2-ylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 155315102) has the molecular formula C19H18N6O3S and a molecular weight of 410.46 g/mol. Its IUPAC name is (2R,3R,4S)-2-(6-aminopurin-9-yl)-5-(quinolin-2-ylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(6-aminopurin-9-yl)-5-(quinolin-2-ylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 155315102 |
| Molecular Formula | C19H18N6O3S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (2R,3R,4S)-2-(6-aminopurin-9-yl)-5-(quinolin-2-ylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1OC(CSc2ccc3ccccc3n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H18N6O3S/c20-17-14-18(22-8-21-17)25(9-23-14)19-16(27)15(26)12(28-19)7-29-13-6-5-10-3-1-2-4-11(10)24-13/h1-6,8-9,12,15-16,19,26-27H,7H2,(H2,20,21,22)/t12?,15-,16-,19-/m1/s1 |
| InChIKey | SGSWFEQDPUFITR-XFWKGRBESA-N |
| XLogP | 1.37 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |